C16H18N2O6 — CID 168570589
dimethyl (E)-2-[(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]but-2-enedioate (PubChem CID 168570589) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is dimethyl (E)-2-[(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168570589 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | dimethyl (E)-2-[(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc2c(c1)NC(=O)C(C)(C)O2)C(=O)OC |
| InChI | InChI=1S/C16H18N2O6/c1-16(2)15(21)18-10-7-9(5-6-12(10)24-16)17-11(14(20)23-4)8-13(19)22-3/h5-8,17H,1-4H3,(H,18,21)/b11-8+ |
| InChIKey | MSKCMZJPPZWSPR-DHZHZOJOSA-N |
| XLogP | 1.44 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|