C36H37N5O — CID 12990786
1-(3,5-ditert-butylphenyl)-3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]urea (PubChem CID 12990786) has the molecular formula C36H37N5O and a molecular weight of 555.73 g/mol. Its IUPAC name is 1-(3,5-ditert-butylphenyl)-3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]urea.
| Compound Name | 1-(3,5-ditert-butylphenyl)-3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]urea |
|---|---|
| PubChem CID | 12990786 |
| Molecular Formula | C36H37N5O |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | 1-(3,5-ditert-butylphenyl)-3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2cccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H37N5O/c1-35(2,3)26-21-27(36(4,5)6)23-29(22-26)40-34(42)39-28-13-11-12-24(18-28)25-19-32(30-14-7-9-16-37-30)41-33(20-25)31-15-8-10-17-38-31/h7-23H,1-6H3,(H2,39,40,42) |
| InChIKey | UIMYQPLPEDKCDF-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |