C16H48Si8 — CID 12992109
trimethyl-[2,2,3,3-tetramethyl-1,4,4-tris(trimethylsilyl)tetrasiletan-1-yl]silane (PubChem CID 12992109) has the molecular formula C16H48Si8 and a molecular weight of 465.25 g/mol. Its IUPAC name is trimethyl-[2,2,3,3-tetramethyl-1,4,4-tris(trimethylsilyl)tetrasiletan-1-yl]silane.
| Compound Name | trimethyl-[2,2,3,3-tetramethyl-1,4,4-tris(trimethylsilyl)tetrasiletan-1-yl]silane |
|---|---|
| PubChem CID | 12992109 |
| Molecular Formula | C16H48Si8 |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | trimethyl-[2,2,3,3-tetramethyl-1,4,4-tris(trimethylsilyl)tetrasiletan-1-yl]silane |
| SMILES | C[Si](C)(C)[Si]1([Si](C)(C)C)[Si](C)(C)[Si](C)(C)[Si]1([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H48Si8/c1-17(2,3)23(18(4,5)6)21(13,14)22(15,16)24(23,19(7,8)9)20(10,11)12/h1-16H3 |
| InChIKey | DQPBBFYNGGPUIT-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|