C18H48Si6 — CID 12702775
trimethyl-[1,1,3,3-tetramethyl-2,4,4-tris(trimethylsilyl)-1,3-disiletan-2-yl]silane (PubChem CID 12702775) has the molecular formula C18H48Si6 and a molecular weight of 433.10 g/mol. Its IUPAC name is trimethyl-[1,1,3,3-tetramethyl-2,4,4-tris(trimethylsilyl)-1,3-disiletan-2-yl]silane.
| Compound Name | trimethyl-[1,1,3,3-tetramethyl-2,4,4-tris(trimethylsilyl)-1,3-disiletan-2-yl]silane |
|---|---|
| PubChem CID | 12702775 |
| Molecular Formula | C18H48Si6 |
| Molecular Weight | 433.10 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | trimethyl-[1,1,3,3-tetramethyl-2,4,4-tris(trimethylsilyl)-1,3-disiletan-2-yl]silane |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)([Si](C)(C)C)[Si]1(C)C |
| InChI | InChI=1S/C18H48Si6/c1-19(2,3)17(20(4,5)6)23(13,14)18(21(7,8)9,22(10,11)12)24(17,15)16/h1-16H3 |
| InChIKey | HTZKQFYZOSMPJT-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.10 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|