C15H15NO5 — CID 12995491
ethyl (1R,2R,4R,7R)-5-oxo-7-phenyl-3,8-dioxa-6-azatricyclo[4.3.0.02,4]nonane-4-carboxylate (PubChem CID 12995491) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is ethyl (1R,2R,4R,7R)-5-oxo-7-phenyl-3,8-dioxa-6-azatricyclo[4.3.0.02,4]nonane-4-carboxylate.
| Compound Name | ethyl (1R,2R,4R,7R)-5-oxo-7-phenyl-3,8-dioxa-6-azatricyclo[4.3.0.02,4]nonane-4-carboxylate |
|---|---|
| PubChem CID | 12995491 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | ethyl (1R,2R,4R,7R)-5-oxo-7-phenyl-3,8-dioxa-6-azatricyclo[4.3.0.02,4]nonane-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@@H]1[C@H]1CO[C@H](c3ccccc3)N1C2=O |
| InChI | InChI=1S/C15H15NO5/c1-2-19-14(18)15-11(21-15)10-8-20-12(16(10)13(15)17)9-6-4-3-5-7-9/h3-7,10-12H,2,8H2,1H3/t10-,11-,12-,15-/m1/s1 |
| InChIKey | FPZRORXOXQHJPA-RTWAVKEYSA-N |
| XLogP | 0.63 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|