C30H30N2O7 — CID 12997025
methyl 2-[1-(2-amino-4,5-dimethylphenyl)-2-hydroxy-4-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-3-oxopyrrol-2-yl]acetate (PubChem CID 12997025) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is methyl 2-[1-(2-amino-4,5-dimethylphenyl)-2-hydroxy-4-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-3-oxopyrrol-2-yl]acetate.
| Compound Name | methyl 2-[1-(2-amino-4,5-dimethylphenyl)-2-hydroxy-4-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-3-oxopyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 12997025 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | methyl 2-[1-(2-amino-4,5-dimethylphenyl)-2-hydroxy-4-(4-methoxybenzoyl)-5-(4-methoxyphenyl)-3-oxopyrrol-2-yl]acetate |
| SMILES | COC(=O)CC1(O)C(=O)C(C(=O)c2ccc(OC)cc2)=C(c2ccc(OC)cc2)N1c1cc(C)c(C)cc1N |
| InChI | InChI=1S/C30H30N2O7/c1-17-14-23(31)24(15-18(17)2)32-27(19-6-10-21(37-3)11-7-19)26(29(35)30(32,36)16-25(33)39-5)28(34)20-8-12-22(38-4)13-9-20/h6-15,36H,16,31H2,1-5H3 |
| InChIKey | JYMSUUWAAJLMIC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|