C12H15NS — CID 12998654
6,6-dimethyl-5-phenyl-2,3-dihydro-1,4-thiazine (PubChem CID 12998654) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 6,6-dimethyl-5-phenyl-2,3-dihydro-1,4-thiazine.
| Compound Name | 6,6-dimethyl-5-phenyl-2,3-dihydro-1,4-thiazine |
|---|---|
| PubChem CID | 12998654 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 6,6-dimethyl-5-phenyl-2,3-dihydro-1,4-thiazine |
| SMILES | CC1(C)SCCN=C1c1ccccc1 |
| InChI | InChI=1S/C12H15NS/c1-12(2)11(13-8-9-14-12)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | KPQLHVZLPKXFTK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |