C11H11NO2 — CID 130005415
spiro[1H-indole-2,2'-oxolane]-3-one (PubChem CID 130005415) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is spiro[1H-indole-2,2'-oxolane]-3-one.
| Compound Name | spiro[1H-indole-2,2'-oxolane]-3-one |
|---|---|
| PubChem CID | 130005415 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | spiro[1H-indole-2,2'-oxolane]-3-one |
| SMILES | O=C1c2ccccc2NC12CCCO2 |
| InChI | InChI=1S/C11H11NO2/c13-10-8-4-1-2-5-9(8)12-11(10)6-3-7-14-11/h1-2,4-5,12H,3,6-7H2 |
| InChIKey | QIZHZZHMLNPBLB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |