C11H9NOS — CID 171487284
spiro[1H-indole-2,2'-3H-thiophene]-3-one (PubChem CID 171487284) has the molecular formula C11H9NOS and a molecular weight of 203.27 g/mol. Its IUPAC name is spiro[1H-indole-2,2'-3H-thiophene]-3-one.
| Compound Name | spiro[1H-indole-2,2'-3H-thiophene]-3-one |
|---|---|
| PubChem CID | 171487284 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | spiro[1H-indole-2,2'-3H-thiophene]-3-one |
| SMILES | O=C1c2ccccc2NC12CC=CS2 |
| InChI | InChI=1S/C11H9NOS/c13-10-8-4-1-2-5-9(8)12-11(10)6-3-7-14-11/h1-5,7,12H,6H2 |
| InChIKey | ACRXPHKBFWGJBP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |