About S-amino N-acetylcarbamothioate
S-amino N-acetylcarbamothioate (PubChem CID 130016422) has the molecular formula C3H6N2O2S
and a molecular weight of 134.16 g/mol. Its IUPAC name is S-amino N-acetylcarbamothioate.
Molecular Properties
| Compound Name | S-amino N-acetylcarbamothioate |
| PubChem CID | 130016422 |
| Molecular Formula | C3H6N2O2S |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | S-amino N-acetylcarbamothioate |
| SMILES | CC(=O)NC(=O)SN |
| InChI | InChI=1S/C3H6N2O2S/c1-2(6)5-3(7)8-4/h4H2,1H3,(H,5,6,7) |
| InChIKey | LVLRBPWEAYXBPX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-amino N-acetylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-amino N-acetylcarbamothioate?
The IUPAC name of S-amino N-acetylcarbamothioate (CID 130016422) is S-amino N-acetylcarbamothioate.
What is the SMILES notation for S-amino N-acetylcarbamothioate?
The canonical SMILES for S-amino N-acetylcarbamothioate is CC(=O)NC(=O)SN.
What is the InChIKey of S-amino N-acetylcarbamothioate?
The InChIKey is LVLRBPWEAYXBPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O2S/c1-2(6)5-3(7)8-4/h4H2,1H3,(H,5,6,7).
What are the key properties of S-amino N-acetylcarbamothioate?
S-amino N-acetylcarbamothioate has a molecular weight of 134.16 g/mol, XLogP of -0.15, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-amino N-acetylcarbamothioate is sourced from PubChem (CID 130016422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).