About ethane;N-ethanethioylacetamide
ethane;N-ethanethioylacetamide (PubChem CID 142038658) has the molecular formula C6H13NOS
and a molecular weight of 147.24 g/mol. Its IUPAC name is ethane;N-ethanethioylacetamide.
Molecular Properties
| Compound Name | ethane;N-ethanethioylacetamide |
| PubChem CID | 142038658 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | ethane;N-ethanethioylacetamide |
| SMILES | CC.CC(=O)NC(C)=S |
| InChI | InChI=1S/C4H7NOS.C2H6/c1-3(6)5-4(2)7;1-2/h1-2H3,(H,5,6,7);1-2H3 |
| InChIKey | BJNWJZMIUQRBCA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethanethioylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethanethioylacetamide?
The IUPAC name of ethane;N-ethanethioylacetamide (CID 142038658) is ethane;N-ethanethioylacetamide.
What is the SMILES notation for ethane;N-ethanethioylacetamide?
The canonical SMILES for ethane;N-ethanethioylacetamide is CC.CC(=O)NC(C)=S.
What is the InChIKey of ethane;N-ethanethioylacetamide?
The InChIKey is BJNWJZMIUQRBCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS.C2H6/c1-3(6)5-4(2)7;1-2/h1-2H3,(H,5,6,7);1-2H3.
What are the key properties of ethane;N-ethanethioylacetamide?
ethane;N-ethanethioylacetamide has a molecular weight of 147.24 g/mol, XLogP of 1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethanethioylacetamide is sourced from PubChem (CID 142038658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).