C6H8N2O2S2 — CID 122628439
N,N'-di(ethanethioyl)oxamide (PubChem CID 122628439) has the molecular formula C6H8N2O2S2 and a molecular weight of 204.28 g/mol. Its IUPAC name is N,N'-di(ethanethioyl)oxamide.
| Compound Name | N,N'-di(ethanethioyl)oxamide |
|---|---|
| PubChem CID | 122628439 |
| Molecular Formula | C6H8N2O2S2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | N,N'-di(ethanethioyl)oxamide |
| SMILES | CC(=S)NC(=O)C(=O)NC(C)=S |
| InChI | InChI=1S/C6H8N2O2S2/c1-3(11)7-5(9)6(10)8-4(2)12/h1-2H3,(H,7,9,11)(H,8,10,12) |
| InChIKey | SWQSFPIUPZYARJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|