About N-oxido-2-oxopropanamide
N-oxido-2-oxopropanamide (PubChem CID 148548106) has the molecular formula C3H4NO3-
and a molecular weight of 102.07 g/mol. Its IUPAC name is N-oxido-2-oxopropanamide.
Molecular Properties
| Compound Name | N-oxido-2-oxopropanamide |
| PubChem CID | 148548106 |
| Molecular Formula | C3H4NO3- |
| Molecular Weight | 102.07 g/mol |
| Exact Mass | 102.02 |
| IUPAC Name | N-oxido-2-oxopropanamide |
| SMILES | CC(=O)C(=O)N[O-] |
| InChI | InChI=1S/C3H4NO3/c1-2(5)3(6)4-7/h1H3,(H-,4,5,6,7)/q-1 |
| InChIKey | KGMBXJATJIQOPQ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.07 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-oxido-2-oxopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxido-2-oxopropanamide?
The IUPAC name of N-oxido-2-oxopropanamide (CID 148548106) is N-oxido-2-oxopropanamide.
What is the SMILES notation for N-oxido-2-oxopropanamide?
The canonical SMILES for N-oxido-2-oxopropanamide is CC(=O)C(=O)N[O-].
What is the InChIKey of N-oxido-2-oxopropanamide?
The InChIKey is KGMBXJATJIQOPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4NO3/c1-2(5)3(6)4-7/h1H3,(H-,4,5,6,7)/q-1.
What are the key properties of N-oxido-2-oxopropanamide?
N-oxido-2-oxopropanamide has a molecular weight of 102.07 g/mol, XLogP of -0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxido-2-oxopropanamide is sourced from PubChem (CID 148548106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).