C9H9NO — CID 130030815
6-methyl-2,3-dihydroindol-5-one (PubChem CID 130030815) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is 6-methyl-2,3-dihydroindol-5-one.
| Compound Name | 6-methyl-2,3-dihydroindol-5-one |
|---|---|
| PubChem CID | 130030815 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 6-methyl-2,3-dihydroindol-5-one |
| SMILES | CC1=CC2=NCCC2=CC1=O |
| InChI | InChI=1S/C9H9NO/c1-6-4-8-7(2-3-10-8)5-9(6)11/h4-5H,2-3H2,1H3 |
| InChIKey | GEJLSJTZRQARHG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|