C9H10O3 — CID 130032021
4-hydroxy-4-(2-oxopropyl)cyclohexa-2,5-dien-1-one (PubChem CID 130032021) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-hydroxy-4-(2-oxopropyl)cyclohexa-2,5-dien-1-one.
| Compound Name | 4-hydroxy-4-(2-oxopropyl)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 130032021 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4-hydroxy-4-(2-oxopropyl)cyclohexa-2,5-dien-1-one |
| SMILES | CC(=O)CC1(O)C=CC(=O)C=C1 |
| InChI | InChI=1S/C9H10O3/c1-7(10)6-9(12)4-2-8(11)3-5-9/h2-5,12H,6H2,1H3 |
| InChIKey | PHYJQNVIKKCEIM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |