C14H22O2 — CID 132992250
2,4-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-one (PubChem CID 132992250) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,4-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-one.
| Compound Name | 2,4-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 132992250 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2,4-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(O)(C(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C14H22O2/c1-12(2,3)10-9-14(16,13(4,5)6)8-7-11(10)15/h7-9,16H,1-6H3 |
| InChIKey | KLJUWZFXUSOSEH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |