C11H14O3 — CID 130034598
2-(1-hydroxy-3-methylbut-3-enyl)benzene-1,4-diol (PubChem CID 130034598) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(1-hydroxy-3-methylbut-3-enyl)benzene-1,4-diol.
| Compound Name | 2-(1-hydroxy-3-methylbut-3-enyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 130034598 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(1-hydroxy-3-methylbut-3-enyl)benzene-1,4-diol |
| SMILES | C=C(C)CC(O)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H14O3/c1-7(2)5-11(14)9-6-8(12)3-4-10(9)13/h3-4,6,11-14H,1,5H2,2H3 |
| InChIKey | QXSFTXZCENCUMA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|