About 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one
6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one (PubChem CID 130037247) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one.
Analyze 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one?
The IUPAC name of 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one (CID 130037247) is 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one.
What is the SMILES notation for 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one?
The canonical SMILES for 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one is CC12CC(=O)C3OC(C1)C3(C)O2.
What is the InChIKey of 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one?
The InChIKey is FUVDZPRREMFVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-8-3-5(10)7-9(2,12-8)6(4-8)11-7/h6-7H,3-4H2,1-2H3.
What are the key properties of 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one?
6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one has a molecular weight of 168.19 g/mol, XLogP of 0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-one is sourced from PubChem (CID 130037247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).