C8H4F2N2S — CID 130052528
2-(2,4-difluorophenyl)-1,3,4-thiadiazole (PubChem CID 130052528) has the molecular formula C8H4F2N2S and a molecular weight of 198.20 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(2,4-difluorophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130052528 |
| Molecular Formula | C8H4F2N2S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,3,4-thiadiazole |
| SMILES | Fc1ccc(-c2nncs2)c(F)c1 |
| InChI | InChI=1S/C8H4F2N2S/c9-5-1-2-6(7(10)3-5)8-12-11-4-13-8/h1-4H |
| InChIKey | UFTNEBWUFJKUJS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |