C8H4ClFN2S — CID 130052550
2-(2-chloro-3-fluorophenyl)-1,3,4-thiadiazole (PubChem CID 130052550) has the molecular formula C8H4ClFN2S and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-(2-chloro-3-fluorophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(2-chloro-3-fluorophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130052550 |
| Molecular Formula | C8H4ClFN2S |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | 2-(2-chloro-3-fluorophenyl)-1,3,4-thiadiazole |
| SMILES | Fc1cccc(-c2nncs2)c1Cl |
| InChI | InChI=1S/C8H4ClFN2S/c9-7-5(2-1-3-6(7)10)8-12-11-4-13-8/h1-4H |
| InChIKey | ZNRWCBOZLQMUPC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |