About (2-aminophenyl)-(1,3-oxazol-5-yl)methanone
(2-aminophenyl)-(1,3-oxazol-5-yl)methanone (PubChem CID 130056733) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is (2-aminophenyl)-(1,3-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | (2-aminophenyl)-(1,3-oxazol-5-yl)methanone |
| PubChem CID | 130056733 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (2-aminophenyl)-(1,3-oxazol-5-yl)methanone |
| SMILES | Nc1ccccc1C(=O)c1cnco1 |
| InChI | InChI=1S/C10H8N2O2/c11-8-4-2-1-3-7(8)10(13)9-5-12-6-14-9/h1-6H,11H2 |
| InChIKey | RCOAGTDTHDOIPP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl)-(1,3-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl)-(1,3-oxazol-5-yl)methanone?
The IUPAC name of (2-aminophenyl)-(1,3-oxazol-5-yl)methanone (CID 130056733) is (2-aminophenyl)-(1,3-oxazol-5-yl)methanone.
What is the SMILES notation for (2-aminophenyl)-(1,3-oxazol-5-yl)methanone?
The canonical SMILES for (2-aminophenyl)-(1,3-oxazol-5-yl)methanone is Nc1ccccc1C(=O)c1cnco1.
What is the InChIKey of (2-aminophenyl)-(1,3-oxazol-5-yl)methanone?
The InChIKey is RCOAGTDTHDOIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c11-8-4-2-1-3-7(8)10(13)9-5-12-6-14-9/h1-6H,11H2.
What are the key properties of (2-aminophenyl)-(1,3-oxazol-5-yl)methanone?
(2-aminophenyl)-(1,3-oxazol-5-yl)methanone has a molecular weight of 188.19 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl)-(1,3-oxazol-5-yl)methanone is sourced from PubChem (CID 130056733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).