C10H6N2O2 — CID 130056906
5-formyl-3-methylfuro[2,3-c]pyridine-7-carbonitrile (PubChem CID 130056906) has the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-formyl-3-methylfuro[2,3-c]pyridine-7-carbonitrile.
| Compound Name | 5-formyl-3-methylfuro[2,3-c]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 130056906 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 5-formyl-3-methylfuro[2,3-c]pyridine-7-carbonitrile |
| SMILES | Cc1coc2c(C#N)nc(C=O)cc12 |
| InChI | InChI=1S/C10H6N2O2/c1-6-5-14-10-8(6)2-7(4-13)12-9(10)3-11/h2,4-5H,1H3 |
| InChIKey | OGNWEDVDFLCJBT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|