C11H14INO — CID 130062553
2-(1-amino-2-cyclopropylethyl)-5-iodophenol (PubChem CID 130062553) has the molecular formula C11H14INO and a molecular weight of 303.14 g/mol. Its IUPAC name is 2-(1-amino-2-cyclopropylethyl)-5-iodophenol.
| Compound Name | 2-(1-amino-2-cyclopropylethyl)-5-iodophenol |
|---|---|
| PubChem CID | 130062553 |
| Molecular Formula | C11H14INO |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-(1-amino-2-cyclopropylethyl)-5-iodophenol |
| SMILES | NC(CC1CC1)c1ccc(I)cc1O |
| InChI | InChI=1S/C11H14INO/c12-8-3-4-9(11(14)6-8)10(13)5-7-1-2-7/h3-4,6-7,10,14H,1-2,5,13H2 |
| InChIKey | IHSFYTIVZZRNSY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|