C8H5ClFNS — CID 130063292
6-chloro-7-fluoro-2-methyl-1,3-benzothiazole (PubChem CID 130063292) has the molecular formula C8H5ClFNS and a molecular weight of 201.65 g/mol. Its IUPAC name is 6-chloro-7-fluoro-2-methyl-1,3-benzothiazole.
| Compound Name | 6-chloro-7-fluoro-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 130063292 |
| Molecular Formula | C8H5ClFNS |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 200.98 |
| IUPAC Name | 6-chloro-7-fluoro-2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2ccc(Cl)c(F)c2s1 |
| InChI | InChI=1S/C8H5ClFNS/c1-4-11-6-3-2-5(9)7(10)8(6)12-4/h2-3H,1H3 |
| InChIKey | YUWRMKSFMWPVKH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |