C12H8NSY- — CID 147870543
2-methyl-7H-benzo[g][1,3]benzothiazol-7-ide;yttrium (PubChem CID 147870543) has the molecular formula C12H8NSY- and a molecular weight of 287.18 g/mol. Its IUPAC name is 2-methyl-7H-benzo[g][1,3]benzothiazol-7-ide;yttrium.
| Compound Name | 2-methyl-7H-benzo[g][1,3]benzothiazol-7-ide;yttrium |
|---|---|
| PubChem CID | 147870543 |
| Molecular Formula | C12H8NSY- |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | 2-methyl-7H-benzo[g][1,3]benzothiazol-7-ide;yttrium |
| SMILES | Cc1nc2ccc3c[c-]ccc3c2s1.[Y] |
| InChI | InChI=1S/C12H8NS.Y/c1-8-13-11-7-6-9-4-2-3-5-10(9)12(11)14-8;/h3-7H,1H3;/q-1; |
| InChIKey | KNFGCXCPINEYTP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|