About 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole
7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole (PubChem CID 45077751) has the molecular formula C8H5N3S2
and a molecular weight of 207.28 g/mol. Its IUPAC name is 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole.
Analyze 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole?
The IUPAC name of 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole (CID 45077751) is 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole.
What is the SMILES notation for 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole?
The canonical SMILES for 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole is Cc1nc2ccc3nnsc3c2s1.
What is the InChIKey of 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole?
The InChIKey is OPEPXEUSQKUBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3S2/c1-4-9-5-2-3-6-8(7(5)12-4)13-11-10-6/h2-3H,1H3.
What are the key properties of 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole?
7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole has a molecular weight of 207.28 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-[1,3]thiazolo[4,5-g][1,2,3]benzothiadiazole is sourced from PubChem (CID 45077751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).