C21H44OSi2 — CID 13006481
tert-butyl-dimethyl-[2-[(1S,3S,5S)-1-methyl-2-methylidene-5-propan-2-yl-3-trimethylsilylcyclopentyl]ethoxy]silane (PubChem CID 13006481) has the molecular formula C21H44OSi2 and a molecular weight of 368.75 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[(1S,3S,5S)-1-methyl-2-methylidene-5-propan-2-yl-3-trimethylsilylcyclopentyl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[(1S,3S,5S)-1-methyl-2-methylidene-5-propan-2-yl-3-trimethylsilylcyclopentyl]ethoxy]silane |
|---|---|
| PubChem CID | 13006481 |
| Molecular Formula | C21H44OSi2 |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | tert-butyl-dimethyl-[2-[(1S,3S,5S)-1-methyl-2-methylidene-5-propan-2-yl-3-trimethylsilylcyclopentyl]ethoxy]silane |
| SMILES | C=C1[C@@H]([Si](C)(C)C)C[C@@H](C(C)C)[C@]1(C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44OSi2/c1-16(2)18-15-19(23(8,9)10)17(3)21(18,7)13-14-22-24(11,12)20(4,5)6/h16,18-19H,3,13-15H2,1-2,4-12H3/t18-,19-,21+/m0/s1 |
| InChIKey | CYNCRGFDUAWZDQ-IRFCIJBXSA-N |
| XLogP | 7.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|