C8H4ClN3 — CID 130066376
5-chloroimidazo[1,5-a]pyridine-7-carbonitrile (PubChem CID 130066376) has the molecular formula C8H4ClN3 and a molecular weight of 177.59 g/mol. Its IUPAC name is 5-chloroimidazo[1,5-a]pyridine-7-carbonitrile.
| Compound Name | 5-chloroimidazo[1,5-a]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 130066376 |
| Molecular Formula | C8H4ClN3 |
| Molecular Weight | 177.59 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 5-chloroimidazo[1,5-a]pyridine-7-carbonitrile |
| SMILES | N#Cc1cc(Cl)n2cncc2c1 |
| InChI | InChI=1S/C8H4ClN3/c9-8-2-6(3-10)1-7-4-11-5-12(7)8/h1-2,4-5H |
| InChIKey | HUIPUHHIDGZBEV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|