C14H9Cl2N4+ — CID 123819559
3,5-dichloro-4-(5-methylpyrazolo[4,3-c]pyridin-5-ium-2-yl)benzonitrile (PubChem CID 123819559) has the molecular formula C14H9Cl2N4+ and a molecular weight of 304.16 g/mol. Its IUPAC name is 3,5-dichloro-4-(5-methylpyrazolo[4,3-c]pyridin-5-ium-2-yl)benzonitrile.
| Compound Name | 3,5-dichloro-4-(5-methylpyrazolo[4,3-c]pyridin-5-ium-2-yl)benzonitrile |
|---|---|
| PubChem CID | 123819559 |
| Molecular Formula | C14H9Cl2N4+ |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 3,5-dichloro-4-(5-methylpyrazolo[4,3-c]pyridin-5-ium-2-yl)benzonitrile |
| SMILES | C[n+]1ccc2nn(-c3c(Cl)cc(C#N)cc3Cl)cc2c1 |
| InChI | InChI=1S/C14H9Cl2N4/c1-19-3-2-13-10(7-19)8-20(18-13)14-11(15)4-9(6-17)5-12(14)16/h2-5,7-8H,1H3/q+1 |
| InChIKey | JTIYLOZFNGJGFU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|