C18H13Cl2FN8 — CID 173324513
N'-[(1Z)-3-amino-1-[[2-(2,6-dichloro-4-cyanophenyl)-7-fluoropyrazolo[4,3-c]pyridin-4-yl]amino]buta-1,3-dienyl]methanimidamide (PubChem CID 173324513) has the molecular formula C18H13Cl2FN8 and a molecular weight of 431.26 g/mol. Its IUPAC name is N'-[(1Z)-3-amino-1-[[2-(2,6-dichloro-4-cyanophenyl)-7-fluoropyrazolo[4,3-c]pyridin-4-yl]amino]buta-1,3-dienyl]methanimidamide.
| Compound Name | N'-[(1Z)-3-amino-1-[[2-(2,6-dichloro-4-cyanophenyl)-7-fluoropyrazolo[4,3-c]pyridin-4-yl]amino]buta-1,3-dienyl]methanimidamide |
|---|---|
| PubChem CID | 173324513 |
| Molecular Formula | C18H13Cl2FN8 |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N'-[(1Z)-3-amino-1-[[2-(2,6-dichloro-4-cyanophenyl)-7-fluoropyrazolo[4,3-c]pyridin-4-yl]amino]buta-1,3-dienyl]methanimidamide |
| SMILES | C=C(N)/C=C(\N=CN)Nc1ncc(F)c2nn(-c3c(Cl)cc(C#N)cc3Cl)cc12 |
| InChI | InChI=1S/C18H13Cl2FN8/c1-9(24)2-15(26-8-23)27-18-11-7-29(28-16(11)14(21)6-25-18)17-12(19)3-10(5-22)4-13(17)20/h2-4,6-8H,1,24H2,(H2,23,26)(H,25,27)/b15-2+ |
| InChIKey | CCBPJBYABDSGQX-RSSMCMFDSA-N |
| XLogP | 3.45 |
| TPSA | 130.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|