C19H14BrCl2N7 — CID 173324652
N'-[(1Z)-1-[[7-bromo-2-(2,6-dichloro-4-cyanophenyl)pyrazolo[4,3-c]pyridin-4-yl]amino]-3-methylbuta-1,3-dienyl]methanimidamide (PubChem CID 173324652) has the molecular formula C19H14BrCl2N7 and a molecular weight of 491.18 g/mol. Its IUPAC name is N'-[(1Z)-1-[[7-bromo-2-(2,6-dichloro-4-cyanophenyl)pyrazolo[4,3-c]pyridin-4-yl]amino]-3-methylbuta-1,3-dienyl]methanimidamide.
| Compound Name | N'-[(1Z)-1-[[7-bromo-2-(2,6-dichloro-4-cyanophenyl)pyrazolo[4,3-c]pyridin-4-yl]amino]-3-methylbuta-1,3-dienyl]methanimidamide |
|---|---|
| PubChem CID | 173324652 |
| Molecular Formula | C19H14BrCl2N7 |
| Molecular Weight | 491.18 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | N'-[(1Z)-1-[[7-bromo-2-(2,6-dichloro-4-cyanophenyl)pyrazolo[4,3-c]pyridin-4-yl]amino]-3-methylbuta-1,3-dienyl]methanimidamide |
| SMILES | C=C(C)/C=C(\N=CN)Nc1ncc(Br)c2nn(-c3c(Cl)cc(C#N)cc3Cl)cc12 |
| InChI | InChI=1S/C19H14BrCl2N7/c1-10(2)3-16(26-9-24)27-19-12-8-29(28-17(12)13(20)7-25-19)18-14(21)4-11(6-23)5-15(18)22/h3-5,7-9H,1H2,2H3,(H2,24,26)(H,25,27)/b16-3+ |
| InChIKey | RVQGRJCZESUMSY-HQYXKAPLSA-N |
| XLogP | 5.18 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.18 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|