C19H17ClF2N6O — CID 173324757
N'-[(1Z)-1-[[2-(2-chloro-6-fluorophenyl)-7-fluoropyrazolo[4,3-c]pyridin-4-yl]amino]-3-(hydroxymethyl)buta-1,3-dienyl]ethanimidamide (PubChem CID 173324757) has the molecular formula C19H17ClF2N6O and a molecular weight of 418.84 g/mol. Its IUPAC name is N'-[(1Z)-1-[[2-(2-chloro-6-fluorophenyl)-7-fluoropyrazolo[4,3-c]pyridin-4-yl]amino]-3-(hydroxymethyl)buta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1Z)-1-[[2-(2-chloro-6-fluorophenyl)-7-fluoropyrazolo[4,3-c]pyridin-4-yl]amino]-3-(hydroxymethyl)buta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 173324757 |
| Molecular Formula | C19H17ClF2N6O |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N'-[(1Z)-1-[[2-(2-chloro-6-fluorophenyl)-7-fluoropyrazolo[4,3-c]pyridin-4-yl]amino]-3-(hydroxymethyl)buta-1,3-dienyl]ethanimidamide |
| SMILES | C=C(/C=C(\N=C(C)N)Nc1ncc(F)c2nn(-c3c(F)cccc3Cl)cc12)CO |
| InChI | InChI=1S/C19H17ClF2N6O/c1-10(9-29)6-16(25-11(2)23)26-19-12-8-28(27-17(12)15(22)7-24-19)18-13(20)4-3-5-14(18)21/h3-8,29H,1,9H2,2H3,(H2,23,25)(H,24,26)/b16-6+ |
| InChIKey | KYYHRLFDJVXJSU-OMCISZLKSA-N |
| XLogP | 3.53 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|