C12H19BrN2O2 — CID 130067972
tert-butyl 3-(bromomethyl)-3-cyanopiperidine-1-carboxylate (PubChem CID 130067972) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is tert-butyl 3-(bromomethyl)-3-cyanopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(bromomethyl)-3-cyanopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 130067972 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | tert-butyl 3-(bromomethyl)-3-cyanopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C#N)(CBr)C1 |
| InChI | InChI=1S/C12H19BrN2O2/c1-11(2,3)17-10(16)15-6-4-5-12(7-13,8-14)9-15/h4-7,9H2,1-3H3 |
| InChIKey | WUVOJSPXNSBOHG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|