C8H6F5NO2 — CID 130085380
6-(difluoromethyl)-3-(hydroxymethyl)-5-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 130085380) has the molecular formula C8H6F5NO2 and a molecular weight of 243.13 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-(hydroxymethyl)-5-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 6-(difluoromethyl)-3-(hydroxymethyl)-5-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130085380 |
| Molecular Formula | C8H6F5NO2 |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 6-(difluoromethyl)-3-(hydroxymethyl)-5-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(C(F)F)c(C(F)(F)F)cc1CO |
| InChI | InChI=1S/C8H6F5NO2/c9-6(10)5-4(8(11,12)13)1-3(2-15)7(16)14-5/h1,6,15H,2H2,(H,14,16) |
| InChIKey | HFFOBLCBJVUPOC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |