C8H7F5N2O — CID 130106020
4-(difluoromethyl)-6-methoxy-5-(trifluoromethyl)pyridin-3-amine (PubChem CID 130106020) has the molecular formula C8H7F5N2O and a molecular weight of 242.15 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-methoxy-5-(trifluoromethyl)pyridin-3-amine.
| Compound Name | 4-(difluoromethyl)-6-methoxy-5-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 130106020 |
| Molecular Formula | C8H7F5N2O |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 4-(difluoromethyl)-6-methoxy-5-(trifluoromethyl)pyridin-3-amine |
| SMILES | COc1ncc(N)c(C(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C8H7F5N2O/c1-16-7-5(8(11,12)13)4(6(9)10)3(14)2-15-7/h2,6H,14H2,1H3 |
| InChIKey | HLPLGBYDJCMJMR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |