C9H11BrN2O — CID 130115658
(2-bromo-7,8-dihydro-5H-pyrano[4,3-b]pyridin-4-yl)methanamine (PubChem CID 130115658) has the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. Its IUPAC name is (2-bromo-7,8-dihydro-5H-pyrano[4,3-b]pyridin-4-yl)methanamine.
| Compound Name | (2-bromo-7,8-dihydro-5H-pyrano[4,3-b]pyridin-4-yl)methanamine |
|---|---|
| PubChem CID | 130115658 |
| Molecular Formula | C9H11BrN2O |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | (2-bromo-7,8-dihydro-5H-pyrano[4,3-b]pyridin-4-yl)methanamine |
| SMILES | NCc1cc(Br)nc2c1COCC2 |
| InChI | InChI=1S/C9H11BrN2O/c10-9-3-6(4-11)7-5-13-2-1-8(7)12-9/h3H,1-2,4-5,11H2 |
| InChIKey | OXTPAFZXHJFOCJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|