About 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol
1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol (PubChem CID 130121969) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol |
| PubChem CID | 130121969 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol |
| SMILES | CCC(O)C1CCC=CO1 |
| InChI | InChI=1S/C8H14O2/c1-2-7(9)8-5-3-4-6-10-8/h4,6-9H,2-3,5H2,1H3 |
| InChIKey | FQPFJFJGMAGJJI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol (CID 130121969) is 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol is CCC(O)C1CCC=CO1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol?
The InChIKey is FQPFJFJGMAGJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-2-7(9)8-5-3-4-6-10-8/h4,6-9H,2-3,5H2,1H3.
What are the key properties of 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol?
1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol has a molecular weight of 142.20 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-2-yl)propan-1-ol is sourced from PubChem (CID 130121969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).