C9H16O3 — CID 130124569
(2-ethoxy-6-methyl-3,4-dihydropyran-2-yl)methanol (PubChem CID 130124569) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (2-ethoxy-6-methyl-3,4-dihydropyran-2-yl)methanol.
| Compound Name | (2-ethoxy-6-methyl-3,4-dihydropyran-2-yl)methanol |
|---|---|
| PubChem CID | 130124569 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (2-ethoxy-6-methyl-3,4-dihydropyran-2-yl)methanol |
| SMILES | CCOC1(CO)CCC=C(C)O1 |
| InChI | InChI=1S/C9H16O3/c1-3-11-9(7-10)6-4-5-8(2)12-9/h5,10H,3-4,6-7H2,1-2H3 |
| InChIKey | KOUKRFPYJFZQTG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |