C11H16O3 — CID 130126180
3-hydroxy-3a,5,6-trimethyl-3,4,7,7a-tetrahydro-2-benzofuran-1-one (PubChem CID 130126180) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-hydroxy-3a,5,6-trimethyl-3,4,7,7a-tetrahydro-2-benzofuran-1-one.
| Compound Name | 3-hydroxy-3a,5,6-trimethyl-3,4,7,7a-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 130126180 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-hydroxy-3a,5,6-trimethyl-3,4,7,7a-tetrahydro-2-benzofuran-1-one |
| SMILES | CC1=C(C)CC2(C)C(O)OC(=O)C2C1 |
| InChI | InChI=1S/C11H16O3/c1-6-4-8-9(12)14-10(13)11(8,3)5-7(6)2/h8,10,13H,4-5H2,1-3H3 |
| InChIKey | OBHGRZRHRINCTK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|