C9H12O3 — CID 163428440
3-hydroxy-6-methyl-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 163428440) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-hydroxy-6-methyl-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | 3-hydroxy-6-methyl-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 163428440 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-hydroxy-6-methyl-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | CC1=CCC2C(O)OC(=O)C2C1 |
| InChI | InChI=1S/C9H12O3/c1-5-2-3-6-7(4-5)9(11)12-8(6)10/h2,6-8,10H,3-4H2,1H3 |
| InChIKey | AOMMUCRFFINPRV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|