About 5-ethylsulfanyloxan-2-ol
5-ethylsulfanyloxan-2-ol (PubChem CID 130129841) has the molecular formula C7H14O2S
and a molecular weight of 162.25 g/mol. Its IUPAC name is 5-ethylsulfanyloxan-2-ol.
Molecular Properties
| Compound Name | 5-ethylsulfanyloxan-2-ol |
| PubChem CID | 130129841 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 5-ethylsulfanyloxan-2-ol |
| SMILES | CCSC1CCC(O)OC1 |
| InChI | InChI=1S/C7H14O2S/c1-2-10-6-3-4-7(8)9-5-6/h6-8H,2-5H2,1H3 |
| InChIKey | TVJBBKDDERGQNO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethylsulfanyloxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfanyloxan-2-ol?
The IUPAC name of 5-ethylsulfanyloxan-2-ol (CID 130129841) is 5-ethylsulfanyloxan-2-ol.
What is the SMILES notation for 5-ethylsulfanyloxan-2-ol?
The canonical SMILES for 5-ethylsulfanyloxan-2-ol is CCSC1CCC(O)OC1.
What is the InChIKey of 5-ethylsulfanyloxan-2-ol?
The InChIKey is TVJBBKDDERGQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2S/c1-2-10-6-3-4-7(8)9-5-6/h6-8H,2-5H2,1H3.
What are the key properties of 5-ethylsulfanyloxan-2-ol?
5-ethylsulfanyloxan-2-ol has a molecular weight of 162.25 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfanyloxan-2-ol is sourced from PubChem (CID 130129841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).