C9H6O5 — CID 130131543
4,6,8-trihydroxychromen-2-one (PubChem CID 130131543) has the molecular formula C9H6O5 and a molecular weight of 194.14 g/mol. Its IUPAC name is 4,6,8-trihydroxychromen-2-one.
| Compound Name | 4,6,8-trihydroxychromen-2-one |
|---|---|
| PubChem CID | 130131543 |
| Molecular Formula | C9H6O5 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 4,6,8-trihydroxychromen-2-one |
| SMILES | O=c1cc(O)c2cc(O)cc(O)c2o1 |
| InChI | InChI=1S/C9H6O5/c10-4-1-5-6(11)3-8(13)14-9(5)7(12)2-4/h1-3,10-12H |
| InChIKey | GLYRDNGBGYNMCI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|