C10H10F2N2 — CID 130134726
2-(4-amino-3,5-difluorophenyl)butanenitrile (PubChem CID 130134726) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-(4-amino-3,5-difluorophenyl)butanenitrile.
| Compound Name | 2-(4-amino-3,5-difluorophenyl)butanenitrile |
|---|---|
| PubChem CID | 130134726 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(4-amino-3,5-difluorophenyl)butanenitrile |
| SMILES | CCC(C#N)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C10H10F2N2/c1-2-6(5-13)7-3-8(11)10(14)9(12)4-7/h3-4,6H,2,14H2,1H3 |
| InChIKey | LOFTYVFLMGOETO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|