C8H14O3 — CID 130142829
(E)-5-(1,3-dioxolan-2-yl)pent-3-en-2-ol (PubChem CID 130142829) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (E)-5-(1,3-dioxolan-2-yl)pent-3-en-2-ol.
| Compound Name | (E)-5-(1,3-dioxolan-2-yl)pent-3-en-2-ol |
|---|---|
| PubChem CID | 130142829 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (E)-5-(1,3-dioxolan-2-yl)pent-3-en-2-ol |
| SMILES | CC(O)/C=C/CC1OCCO1 |
| InChI | InChI=1S/C8H14O3/c1-7(9)3-2-4-8-10-5-6-11-8/h2-3,7-9H,4-6H2,1H3/b3-2+ |
| InChIKey | AXSPZHHUTIPZMO-NSCUHMNNSA-N |
| XLogP | 0.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|