C7H16O4S — CID 130145116
2,3-dihydroxypropyl(dimethyl)sulfanium acetate (PubChem CID 130145116) has the molecular formula C7H16O4S and a molecular weight of 196.27 g/mol. Its IUPAC name is 2,3-dihydroxypropyl(dimethyl)sulfanium acetate.
| Compound Name | 2,3-dihydroxypropyl(dimethyl)sulfanium acetate |
|---|---|
| PubChem CID | 130145116 |
| Molecular Formula | C7H16O4S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2,3-dihydroxypropyl(dimethyl)sulfanium acetate |
| SMILES | CC(=O)[O-].C[S+](C)CC(O)CO |
| InChI | InChI=1S/C5H13O2S.C2H4O2/c1-8(2)4-5(7)3-6;1-2(3)4/h5-7H,3-4H2,1-2H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | LJUKNBVYVHUMSX-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|