C16H14N2O — CID 13017092
2-benzhydrylidene-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 13017092) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-benzhydrylidene-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | 2-benzhydrylidene-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 13017092 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-benzhydrylidene-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N[N+](=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H14N2O/c19-15-11-12-18(17-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | JKFZAQUSWQFHOI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|