About 3-acetamidobut-3-enyl acetate
3-acetamidobut-3-enyl acetate (PubChem CID 130179468) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-acetamidobut-3-enyl acetate.
Molecular Properties
| Compound Name | 3-acetamidobut-3-enyl acetate |
| PubChem CID | 130179468 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 3-acetamidobut-3-enyl acetate |
| SMILES | C=C(CCOC(C)=O)NC(C)=O |
| InChI | InChI=1S/C8H13NO3/c1-6(9-7(2)10)4-5-12-8(3)11/h1,4-5H2,2-3H3,(H,9,10) |
| InChIKey | JBOBFNSBXPICKM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-acetamidobut-3-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamidobut-3-enyl acetate?
The IUPAC name of 3-acetamidobut-3-enyl acetate (CID 130179468) is 3-acetamidobut-3-enyl acetate.
What is the SMILES notation for 3-acetamidobut-3-enyl acetate?
The canonical SMILES for 3-acetamidobut-3-enyl acetate is C=C(CCOC(C)=O)NC(C)=O.
What is the InChIKey of 3-acetamidobut-3-enyl acetate?
The InChIKey is JBOBFNSBXPICKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-6(9-7(2)10)4-5-12-8(3)11/h1,4-5H2,2-3H3,(H,9,10).
What are the key properties of 3-acetamidobut-3-enyl acetate?
3-acetamidobut-3-enyl acetate has a molecular weight of 171.20 g/mol, XLogP of 0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamidobut-3-enyl acetate is sourced from PubChem (CID 130179468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).