C21H26N6O3 — CID 130182221
3-[3-[4-(oxolan-2-ylmethyl)piperazin-1-yl]propyl]triazolo[4,5-g]quinoline-4,9-dione (PubChem CID 130182221) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-[3-[4-(oxolan-2-ylmethyl)piperazin-1-yl]propyl]triazolo[4,5-g]quinoline-4,9-dione.
| Compound Name | 3-[3-[4-(oxolan-2-ylmethyl)piperazin-1-yl]propyl]triazolo[4,5-g]quinoline-4,9-dione |
|---|---|
| PubChem CID | 130182221 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 3-[3-[4-(oxolan-2-ylmethyl)piperazin-1-yl]propyl]triazolo[4,5-g]quinoline-4,9-dione |
| SMILES | O=C1c2cccnc2C(=O)c2c1nnn2CCCN1CCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C21H26N6O3/c28-20-16-5-1-6-22-17(16)21(29)19-18(20)23-24-27(19)8-3-7-25-9-11-26(12-10-25)14-15-4-2-13-30-15/h1,5-6,15H,2-4,7-14H2 |
| InChIKey | UHFCQDRKAIIPPQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|