C21H28N6O4 — CID 130182251
2-oxido-3-[3-[4-(oxolan-2-ylmethyl)piperazin-1-yl]propyl]-1,2-dihydrotriazolo[4,5-g]quinolin-2-ium-4,9-dione (PubChem CID 130182251) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-oxido-3-[3-[4-(oxolan-2-ylmethyl)piperazin-1-yl]propyl]-1,2-dihydrotriazolo[4,5-g]quinolin-2-ium-4,9-dione.
| Compound Name | 2-oxido-3-[3-[4-(oxolan-2-ylmethyl)piperazin-1-yl]propyl]-1,2-dihydrotriazolo[4,5-g]quinolin-2-ium-4,9-dione |
|---|---|
| PubChem CID | 130182251 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-oxido-3-[3-[4-(oxolan-2-ylmethyl)piperazin-1-yl]propyl]-1,2-dihydrotriazolo[4,5-g]quinolin-2-ium-4,9-dione |
| SMILES | O=C1C2=C(C(=O)c3ncccc31)N(CCCN1CCN(CC3CCCO3)CC1)[NH+]([O-])N2 |
| InChI | InChI=1S/C21H28N6O4/c28-20-16-5-1-6-22-17(16)21(29)19-18(20)23-27(30)26(19)8-3-7-24-9-11-25(12-10-24)14-15-4-2-13-31-15/h1,5-6,15,23,27H,2-4,7-14H2 |
| InChIKey | QEWVDHNMGQFULT-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|