C17H26ClFN2O — CID 130184580
3-chloro-5-[(4-fluoro-4-propan-2-ylpiperidin-1-yl)methyl]-2-propan-2-yloxypyridine (PubChem CID 130184580) has the molecular formula C17H26ClFN2O and a molecular weight of 328.86 g/mol. Its IUPAC name is 3-chloro-5-[(4-fluoro-4-propan-2-ylpiperidin-1-yl)methyl]-2-propan-2-yloxypyridine.
| Compound Name | 3-chloro-5-[(4-fluoro-4-propan-2-ylpiperidin-1-yl)methyl]-2-propan-2-yloxypyridine |
|---|---|
| PubChem CID | 130184580 |
| Molecular Formula | C17H26ClFN2O |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3-chloro-5-[(4-fluoro-4-propan-2-ylpiperidin-1-yl)methyl]-2-propan-2-yloxypyridine |
| SMILES | CC(C)Oc1ncc(CN2CCC(F)(C(C)C)CC2)cc1Cl |
| InChI | InChI=1S/C17H26ClFN2O/c1-12(2)17(19)5-7-21(8-6-17)11-14-9-15(18)16(20-10-14)22-13(3)4/h9-10,12-13H,5-8,11H2,1-4H3 |
| InChIKey | GBQIXZCCWCIVTD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |